There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 492-61-5 |
| Synonyms | beta-D-glucose; beta-D-glucopyranose; 492-61-5; glucoside; beta-glucose |
| Formula | C6H12O6 |
| MW | 180.16 |
| MDL No. | MFCD00212920 |
| InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6-/m1/s1 |
| InChI Key | WQZGKKKJIJFFOK-VFUOTHLCSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |