There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| Inquiry |
| CAS | 13264-95-4 |
| Synonyms | Isomaltosylmaltose; 6-O-(A-D-MALTOTRIOSYL)-D-GLUCOPYRANOSE; 13264-95-4; isomaltosyl maltose; O-GMT |
| Formula | C24H42O21 |
| MW | 666.59 |
| MDL No. | MFCD09840666 |
| InChI | InChI=1S/C24H42O21/c25-1-5-9(28)11(30)16(35)22(41-5)39-4-8-10(29)12(31)17(36)23(43-8)45-20-7(3-27)42-24(18(37)14(20)33)44-19-6(2-26)40-21(38)15(34)13(19)32/h5-38H,1-4H2/t5-,6-,7-,8-,9-,10-,11+,12+,13-,14-,15-,16-,17-,18-,19-,20-,21?,22+,23-,24-/m1/s1 |
| InChI Key | FPBCRLIOSBQLHS-QVTSYAGHSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |