There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 10 g | ||
| 25 g | ||
| 50 g |
| CAS | 7784-54-5 |
| Synonyms | 7784-54-5; (2R,3R,4R,5S,6R)-3-Acetamido-6-(acetoxymethyl)tetrahydro-2H-pyran-2,4,5-triyl triacetate; C16H23NO10; 2-ACETAMIDO-2-DEOXY-1,3,4,6-TETRA-O-ACETYL-ALPHA-D-GLUCOPYRANOSE; ALPHA-D-GLUCOSAMINE PENTAACETATE |
| Formula | C16H23NO10 |
| MW | 389.36 |
| MDL No. | MFCD00065051 |
| InChI | InChI=1S/C16H23NO10/c1-7(18)17-13-15(25-10(4)21)14(24-9(3)20)12(6-23-8(2)19)27-16(13)26-11(5)22/h12-16H,6H2,1-5H3,(H,17,18)/t12-,13-,14-,15-,16+/m1/s1 |
| InChI Key | OVPIZHVSWNOZMN-QCODTGAPSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |