There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 1 g | ||
| 2 g | ||
| 3 g | ||
| 5 g |
| CAS | 384329-76-4 |
| Synonyms | Abacavir 5'-beta-D-Glucuronide; 384329-76-4; abacavir glucuronide; UNII-2630IZQ0I0; abacavir glucosiduronic acid |
| Formula | C20H26N6O7 |
| MW | 462.46 |
| MDL No. | MFCD11977960 |
| InChI | InChI=1S/C20H26N6O7/c21-20-24-16(23-9-2-3-9)11-17(25-20)26(7-22-11)10-4-1-8(5-10)6-32-19-14(29)12(27)13(28)15(33-19)18(30)31/h1,4,7-10,12-15,19,27-29H,2-3,5-6H2,(H,30,31)(H3,21,23,24,25)/t8-,10+,12+,13+,14-,15+,19-/m1/s1 |
| InChI Key | WGTDUQBKKUUVMK-OLMRCODSSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |