There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 100 g | ||
| 250 g | ||
| 500 g | ||
| 1 kg |
| CAS | 5965-66-2 |
| Synonyms | (+)-Lactose; 5965-66-2; 4-(beta-D-Galactosido)-D-glucose; 4-O-beta-D-Galactopyranosyl-beta-D-glucopyranose; 4-O-beta-D-Galactopyranosyl-D-glucose; beta-D-Glucopyranose, 4-O-beta-D-galactopyranosyl-; beta-D-Lactose; beta-Lactose |
| Formula | C12H22O11 |
| MW | 342.3 |
| MDL No. | MFCD00064521 |
| InChI | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-,11-,12+/m1/s1 |
| InChI Key | GUBGYTABKSRVRQ-DCSYEGIMSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |