There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 50 g | ||
| 100 g | ||
| 250 g | ||
| 500 g |
| CAS | 534-42-9 |
| Synonyms | Maltobionic acid; UNII-47RDD4XT2O; 47RDD4XT2O; 534-42-9; Maltobionsaure |
| Formula | C12H22O12 |
| MW | 358.3 |
| InChI | InChI=1S/C12H22O12/c13-1-3(15)10(7(18)8(19)11(21)22)24-12-9(20)6(17)5(16)4(2-14)23-12/h3-10,12-20H,1-2H2,(H,21,22)/t3-,4-,5-,6+,7-,8-,9-,10-,12-/m1/s1 |
| InChI Key | JYTUSYBCFIZPBE-QOKIMYEXSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |