1,3-b-D-Mannosyl-D-glucose

1,3-b-D-Mannosyl-D-glucose is a disaccharide, a sugar made of two units: a mannose molecule and a glucose molecule. The specific β-1,3 linkage between them is what makes this compound unique and valuable. It is primarily used as a reference standard in carbohydrate analysis to help researchers identify and quantify similar disaccharides in complex mixtures. Its distinct structure also makes it an ideal substrate for studying the specificity of glycosidases-enzymes that break down carbohydrates. By studying how these enzymes interact with this specific compound, scientists can better understand carbohydrate metabolism in plants, animals, and microorganisms.

1,3-β-D-Mannosyl-D-glucose; β-D-Mannosyl-D-glucose; 3-O-alpha-D-mannosyl-D-glucose; SCHEMBL16431791

C₁₂H₂₂O₁₁

342.3

InChI=1S/C12H22O11/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19) 6(3-15)22-12/h2,4-13,15-21H,1,3H2/t4-,5+,6-,7-,8-,9+,10+,11-,12-/m1/s1

YGEHCIVVZVBCLE-BRVRUOOLSA-N

Min 95%

White to off-white powder

Conforms to structure

Store at -20°C for long term storage.